You have no items in your shopping cart.
Cart summary
OABK hydrochloride
Catalog Number: orb611461
| Catalog Number | orb611461 |
|---|---|
| Category | Small Molecules |
| Description | A synthetic amino acid that fuctions as a small molecule switch for activation of protein function through the site-specific incorporation. |
| CAS Number | [1984862-48-7] |
| MW | 357.7927 |
| SMILES | C1=CC=C(C(=C1)COC(=O)NCCCC[C@@H](C(=O)O)N)N=[N+]=[N-].Cl |
| Formula | C14H20ClN5O4 |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
