You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb746349 |
---|---|
Category | Small Molecules |
Description | Nicotinamide Mononucleotide, also known as ("NMN" and "β-NMN") is a nucleotide derived from ribose and nicotinamide Like nicotinamide riboside, NMN is a derivative of niacin, and humans have enzymes that can use NMN to generate nicotinamide adenine dinuc |
CAS Number | [1094-61-7] |
MW | 334.2208 |
SMILES | O=P(OC[C@H]1O[C@@H]([N+]2=CC=CC(C(N)=O)=C2)[C@H](O)[C@@H]1O)([O-])O |
Formula | C11H15N2O8P |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
ELISA, FC, IF, WB | |
Canine, Human | |
Goat | |
Polyclonal | |
Unconjugated |