You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2813737 |
---|---|
Category | Small Molecules |
Description | Nerofe, as the natural ligand for the ST2 receptor, plays a crucial role in the immune system response. |
CAS Number | 2120397-85-3 |
MW | 1897.18 |
SMILES | C([C@H](C(N[C@@H](C(N[C@@H](C(N[C@H](CCCCN)C(O)=O)=O)CCCNC(=N)N)=O)CCC(O)=O)=O)NC([C@H](NC([C@H](NC([C@H](NC(=O)[C@@H]1N(C([C@H](NC([C@@H](CC2=CC=CC=C2)NC([C@@H](CC3=CC=CC=C3)NC([C@H](NC([C@@H](CC=4C=5C(NC4)=CC=CC5)NC([C@@H](CC=6C=7C(NC6)=CC=CC7)N)=O)=O)[C@H](C)O)=O)=O)=O)CC(C)C)=O)CCC1)CO)=O)[C@H](C)O)=O)CC(C)C)=O)C=8C=9C(NC8)=CC=CC9 |
Formula | C96H129N21O20 |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |