You have no items in your shopping cart.
Cart summary
Nelonicline
Catalog Number: orb1706921
| Catalog Number | orb1706921 |
|---|---|
| Category | Small Molecules |
| Description | Nelonicline |
| CAS Number | 1026134-63-3 |
| Purity | 98% |
| MW | 313.42 |
| SMILES | C1C2CC3CN(C2)CC1C3Oc1nnc(s1)-c1ccccc1 |
| Formula | C17H19N3OS |
| Biological Activity | Nelonicline is a selective agonist of neuronal nicotinic receptors. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
