You have no items in your shopping cart.
Cart summary
N6-Methyl-2-methylthioadenosine
Catalog Number: orb1741475
| Catalog Number | orb1741475 |
|---|---|
| Category | Small Molecules |
| Description | N6-Methyl-2-methylthioadenosine |
| CAS Number | 13406-51-4 |
| Purity | 0.98 |
| MW | 327.36 |
| SMILES | O[C@H]1[C@H](N2C=3C(N=C2)=C(NC)N=C(SC)N3)O[C@H](CO)[C@H]1O |
| Formula | C12H17N5O4S |
| Biological Activity | N6-Methyl-2-methylthioadenosine is a thiomethylated protected nucleotide that can be used in the synthesis of nucleoside derivatives. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
