You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1709063 |
---|---|
Category | Small Molecules |
Description | N-Desethyl amodiaquine |
CAS Number | 79352-78-6 |
Purity | 98% |
MW | 327.81 |
SMILES | CCNCc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1O |
Formula | C18H18ClN3O |
Biological Activity | N-Desethyl amodiaquine is an antiparasitic agent and the major bioactive amodiaquine metabolite. Its IC50 values against strains V1/S and 3D7 were 97 nM and 25 nM, respectively. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.83% | |
79049-30-2 | |
400.73 | |
C18H20Cl3N3O |
[79049-30-2] | |
400.729901313782 | |
C18H20CL3N3O |