You have no items in your shopping cart.
Cart summary
MSX-130
Catalog Number: orb1303275
| Catalog Number | orb1303275 |
|---|---|
| Category | Small Molecules |
| Description | MSX-130 |
| CAS Number | 4051-59-6 |
| Purity | 99.81% |
| MW | 514.62 |
| SMILES | c1ccc(cc1)-c1nc([nH]c1-c1ccccc1)-c1ccc(cc1)-c1nc(c([nH]1)-c1ccccc1)-c1ccccc1 |
| Formula | C36H26N4 |
| Biological Activity | MSX-130 is CXCR4 Antagonist. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
