You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb422156 |
---|---|
Category | Small Molecules |
Description | Moxifloxacin(Avelox, Avalox) is a fourth generation synthetic fluoroquinolone antibacterial agent. |
CAS Number | [186826-86-8] |
MW | 437.9 |
SMILES | Cl[H].FC1C([H])=C2C(C(C(=O)O[H])=C([H])N(C2=C(C=1N1C([H])([H])[C@]2([H])[C@@]([H])(C([H])([H])C([H])([H])C([H])([H])N2[H])C1([H])[H])OC([H])([H])[H])C1([H])C([H])([H])C1([H])[H])=O |
Formula | C21H25ClFN3O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥98% | |
186826-86-8 | |
437.89 | |
C21H24FN3O4 HCl |
99.80% | |
186826-86-8 | |
437.89 | |
C23H29ClFN3O4 |