You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb692032 |
---|---|
Category | Small Molecules |
Description | MMP-9-IN-1 is a specific matrix metalloproteinase-9 (MMP-9) inhibitor, which selectively target the hemopexin (PEX) domain of MMP-9, but not other MMPs. |
CAS Number | [502887-71-0] |
MW | 369.39 |
SMILES | CCCC1=CC(=O)NC(=N1)SCC(=O)NC2=CC=C(C=C2)OC(F)F |
Formula | C16H17F2N3O3S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.75% | |
502887-71-0 | |
369.39 | |
C16H17F2N3O3S |
Filter by Rating