You have no items in your shopping cart.
Cart summary
Metronidazole Benzoate
Catalog Number: orb1709142
| Catalog Number | orb1709142 |
|---|---|
| Category | Small Molecules |
| Description | Metronidazole Benzoate |
| CAS Number | 13182-89-3 |
| Purity | 98% |
| MW | 275.26 |
| SMILES | C(COC(=O)C1=CC=CC=C1)N2C(N(=O)=O)=CN=C2C |
| Formula | C13H13N3O4 |
| Biological Activity | Metronidazole Benzoate (Benzoyl metronidazole) is a derivative of Metronidazole and benzoic acid, which has antibacterial, anti-parasitic and anti-trichomonas functions and is often used to treat infections caused by anaerobic bacteria. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
