You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1089479 |
---|---|
Category | Small Molecules |
Description | MC-Gly-Gly-Phe is a cleavable linker used for antibody-drug conjugates (ADC). |
CAS Number | [1599440-15-9] |
MW | 472.491 |
SMILES | O=C([C@@H](NC(=O)CNC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O)CC1C=CC=CC=1)O |
Formula | C23N4O7H28 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
[1599440-25-1] | |
616.62 | |
C28H36N6O10 |
2414254-52-5 | |
1074.12 | |
C55H60FN9O13 |
2414254-51-4 | |
1074.12 | |
C55H60FN9O13 |
2414254-41-2 | |
1060.09 | |
C54H58FN9O13 |
Filter by Rating