You have no items in your shopping cart.
Cart summary
Lycorine hydrochloride monohydrate
Catalog Number: orb1986916
| Catalog Number | orb1986916 |
|---|---|
| Category | Small Molecules |
| Description | Lycorine hydrochloride monohydrate is a bioactive chemical. |
| CAS Number | 6150-58-9 |
| Purity | 98.00% |
| MW | 341.79 |
| SMILES | O.Cl.[H][C@@]12N3CCC1=C[C@H](O)[C@@H](O)[C@@]2([H])c1cc2OCOc2cc1C3 |
| Formula | C16H20ClNO5 |
| Biological Activity | Lycorine hydrochloride monohydrate is a bioactive chemical. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
