You have no items in your shopping cart.
Cart summary
LOXO-195
Catalog Number: orb1298066
| Catalog Number | orb1298066 |
|---|---|
| Category | Small Molecules |
| Description | LOXO-195 |
| CAS Number | 1350884-56-8 |
| Purity | 97.92% |
| MW | 380.42 |
| SMILES | FC=1C=C2[C@@]3(N(C4=NC=5N(C=C4)N=CC5C(=O)NC(C)CCC2=NC1)CCC3)[H] |
| Formula | C20H21FN6O |
| Biological Activity | (6RS)-LOXO-195 (BAY 2731954) is a potent and selective Trk tyrosine kinase inhibitor. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
