You have no items in your shopping cart.
Cart summary
Loline
Catalog Number: orb1985836
| Catalog Number | orb1985836 |
|---|---|
| Category | Small Molecules |
| Description | Loline is a natural insecticidal and deterrent to a broad range of insects, including species in the Hemiptera, Coleoptera, Hymenoptera, Lepidoptera, and Blattodea orders. Loline deters species such as the bird cherry-oat aphid (genus Rhopalosiphum), large milkweed bug (Oncopeltus fasciatus), and American cockroach (Periplaneta americana), thereby protecting the host plant from insect herbivory. |
| CAS Number | 25161-91-5 |
| Purity | 98.00% |
| MW | 154.21 |
| SMILES | N(C)[C@@H]1[C@]2([C@]3(O[C@@]1(C[N@@]2CC3)[H])[H])[H] |
| Formula | C8H14N2O |
| Biological Activity | Loline is a natural insecticidal and deterrent to a broad range of insects, including species in the Hemiptera, Coleoptera, Hymenoptera, Lepidoptera, and Blattodea orders. Loline deters species such as the bird cherry-oat aphid (genus Rhopalosiphum), large milkweed bug (Oncopeltus fasciatus), and American cockroach (Periplaneta americana), thereby protecting the host plant from insect herbivory. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
