You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303397 |
---|---|
Category | Small Molecules |
Description | Liriopesides B |
CAS Number | 87425-34-1 |
Purity | 99.74% |
MW | 722.9 |
SMILES | [H][C@]12CC3C4CC=C5C[C@H](C[C@@H](O[C@@H]6O[C@H](C)[C@H](O)[C@H](O)[C@H]6O)[C@]5(C)C4CC[C@]3(C)[C@@]1([H])[C@H](C)[C@@]1(CC[C@H](C)CO1)O2)O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O |
Formula | C39H62O12 |
Biological Activity | Liriopesides B (Nolinospiroside F) exhibited potential anticancer activity against human ovarian cancer A2780 cells. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |