You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb363793 |
---|---|
Category | Small Molecules |
Description | AIC246 is a novel anti-CMV compound which targets the viral terminase complex and remains active against virus resistant to DNA polymerase inhibitors. |
CAS Number | [917389-32-3] |
MW | 572.5507 |
SMILES | FC1=C(N=C(N2CCN(C3=CC=CC(OC)=C3)CC2)N(C4=CC(C(F)(F)F)=CC=C4OC)[C@H]5CC(O)=O)C5=CC=C1 |
Formula | C29H28F4N4O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Letermovir
99.85% | |
917389-32-3 | |
572.55 | |
C29H28F4N4O4 |