You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134817 |
---|---|
Category | Small Molecules |
Description | Lapatinib |
CAS Number | [231277-92-2] |
MW | 581.06 |
SMILES | O=S(CCNCC1=CC=C(C2=CC=C3C(C(NC4=CC(Cl)=C(C=C4)OCC5=CC(F)=CC=C5)=NC=N3)=C2)O1)(C)=O |
Formula | C29H26ClFN4O4S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Lapatinib
99.89% | |
231277-92-2 | |
581.06 | |
C29H26ClFN4O4S |
≥99% | |
388082-78-8 | |
925.46 | |
C26H26ClFN4O4S 2C7H8O3S H2O |
> =98% | |
388082-77-7 | |
925.46 | |
C29H26ClFN4O4S.2C7H8O3S |