You have no items in your shopping cart.
Cart summary
L-asarinin
Catalog Number: orb1303777
| Catalog Number | orb1303777 |
|---|---|
| Category | Small Molecules |
| Description | L-asarinin |
| CAS Number | 133-05-1 |
| Purity | 98% |
| MW | 354.35 |
| SMILES | C1Oc2ccc(cc2O1)[C@H]1OC[C@H]2[C@@H]1CO[C@H]2c1ccc2OCOc2c1 |
| Formula | C20H18O6 |
| Biological Activity | L-asarinin ((-)-Episesamin) reduces peripheral blood concentration of IL-12 and inhibits the expression of CXCR3 and TLR4, which means Asarinin may have a role on the TLR4 pathway and produce prolongation of allograft heart survival. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
