You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1685526 |
---|---|
Category | Small Molecules |
Description | KukoaMine B |
CAS Number | 164991-67-7 |
Purity | 99.59% |
MW | 530.66 |
SMILES | NCCCN(CCCCNCCCNC(=O)CCc1ccc(O)c(O)c1)C(=O)CCc1ccc(O)c(O)c1 |
Formula | C28H42N4O6 |
Biological Activity | Kukoamine B, as a constituent of Lycii Cortex, exhibits anti-acute inflammatory, anti-oxidant, and anti-diabetic characteristics. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
1375179-86-4 | |
626.76 | |
C29H46N4O9S |