You have no items in your shopping cart.
Cart summary
KHS101 hydrochloride
Catalog Number: orb1302031
| Catalog Number | orb1302031 |
|---|---|
| Category | Small Molecules |
| Description | KHS101 hydrochloride |
| CAS Number | 1784282-12-7 |
| Purity | 99.60% |
| MW | 375.92 |
| SMILES | Cl.CC(C)CNc1ccnc(NCc2csc(n2)-c2ccccc2)n1 |
| Formula | C18H22ClN5S |
| Biological Activity | KHS101 is a TACC3 inhibitor and can selectively induce a neuronal differentiation phenotype. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
