You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb181055 |
---|---|
Category | Small Molecules |
Description | Merck 5 is a potent and reversible ATP-competitive inhibitor of the JAK kinases (JAK1, JAK2, JAK3, and Tyk2). It also blocks IL2 and IL4 dependent proliferation of CTLL cells and inhibits the phosphorylation of STAT5. |
CAS Number | [457081-03-7] |
MW | 309.3 |
SMILES | CC(C)(C)C1=NC2=C(N1)C3=C(C=C(C=C3)F)C4=C2C=CNC4=O |
Formula | C18H16FN3O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
ICC | |
Bovine, Canine, Equine, Gallus, Mouse, Rabbit, Rat | |
Human | |
Rabbit | |
Polyclonal | |
HRP |
ICC | |
Bovine, Canine, Equine, Gallus, Mouse, Rabbit, Rat | |
Human | |
Rabbit | |
Polyclonal | |
Biotin |
FC, ICC, IF | |
Bovine, Canine, Porcine, Rabbit | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
FITC |
ICC, IF | |
Canine, Equine, Mouse, Porcine, Rabbit | |
Human, Rat | |
Rabbit | |
Polyclonal | |
FITC |
Filter by Rating