You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1684500 |
---|---|
Category | Small Molecules |
Description | Isosilybin B |
CAS Number | 142796-22-3 |
Purity | 98% |
MW | 482.44 |
SMILES | C(O)[C@H]1[C@@H](OC=2C(O1)=CC(=CC2)[C@H]3OC=4C(C(=O)[C@@H]3O)=C(O)C=C(O)C4)C5=CC(OC)=C(O)C=C5 |
Formula | C25H22O10 |
Biological Activity | Isosilybin B is a flavonolignan extracted from silymarin that exhibits anti-prostate cancer (PCA) activity, inhibits cancer cell proliferation, and contributes to G1-phase blockade and apoptosis.Isosilybin B induces degradation of the androgen receptor. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |