You have no items in your shopping cart.
Cart summary
Isoferulic acid
Catalog Number: orb1304884
| Catalog Number | orb1304884 |
|---|---|
| Category | Small Molecules |
| Description | Isoferulic acid |
| CAS Number | 537-73-5 |
| Purity | 99.49% |
| MW | 194.18 |
| SMILES | COC1=C(O)C=C(\C=C\C(O)=O)C=C1 |
| Formula | C10H10O4 |
| Biological Activity | Isoferulic acid (Hesperetate) exhibits hypoglycemic properties. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
