You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb180794 |
---|---|
Category | Small Molecules |
Description | Irinotecan hydrochloride is the hydrochloride salt of a semisynthetic derivative of camptothecin, a cytotoxic, quinoline-based alkaloid extracted from the Asian tree Camptotheca acuminata. |
CAS Number | [100286-90-6] |
MW | 623.139 |
SMILES | Cl.CCC1C2=C(N=C3C=1C=C(C=C3)OC(=O)N4CCC(CC4)N5CCCCC5)C6N(C2)C(=O)C7=C(C=6)[C@](CC)(O)C(=O)OC7 |
Formula | C33H39CLN4O6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥98% | |
136572-09-3 | |
677.19 | |
C33H38N4O6 HCl 3H2O |
[136572-09-3] | |
677.19 | |
C33H45ClN4O9 |