You have no items in your shopping cart.
Cart summary
Indolelactic acid
Catalog Number: orb1296090
| Catalog Number | orb1296090 |
|---|---|
| Category | Small Molecules |
| Description | Indolelactic acid |
| CAS Number | 1821-52-9 |
| Purity | 98.93% |
| MW | 205.21 |
| SMILES | OC(Cc1c[nH]c2ccccc12)C(O)=O |
| Formula | C11H11NO3 |
| Biological Activity | Indolelactic acid is a metabolite of tryptophan in Azotobacter vinelandii cultures. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
