You have no items in your shopping cart.
Cart summary
Incensole acetate
Catalog Number: orb1684525
| Catalog Number | orb1684525 |
|---|---|
| Category | Small Molecules |
| Description | Incensole acetate |
| CAS Number | 34701-53-6 |
| Purity | 98.00% |
| MW | 348.52 |
| SMILES | CC(C)[C@@]12CC[C@@](C)(O1)[C@H](CC\C(C)=C\CC\C(C)=C\C2)OC(C)=O |
| Formula | C22H36O3 |
| Biological Activity | Incensole acetate is a novel anti-inflammatory compound that inhibits NF-κB activation. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
