You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2279583 |
---|---|
Category | Small Molecules |
Description | Inarigivir (ORI-9020) ammonium is a dinucleotide antiviral drug which can significantly reduce liver HBV DNA in transgenic mice expressing hepatitis B virus. Inarigivir (ORI-9020) act as an RIG-I agonist to activate cellular innate immune responses. |
CAS Number | [2172788-92-8] |
MW | 604.53 |
SMILES | O(C)[C@H]1[C@@H](O[C@H](CO)[C@H]1OP(OC[C@H]2O[C@H](C[C@@H]2O)N3C=4C(N=C3)=C(N)N=CN4)(=O)S)N5C(=O)NC(=O)C=C5.N |
Formula | C20H29N8O10PS |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.13% | |
2172788-92-8 | |
604.53 | |
C20H29N8O10PS |
Filter by Rating