You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb181021 |
---|---|
Category | Small Molecules |
Description | IC-87114 was the first isoform-selective PI3K inhibitor. p110δ(IC50 = 0.13 μM) vs. p110α(IC50 = 200 μM), p110β(IC50 = 16 μM) and p110γ(IC50 = 61 μM). |
CAS Number | [371242-69-2] |
MW | 397.43256 |
SMILES | O=C1N(C(CN2C3=C(C(N)=NC=N3)N=C2)=NC4=CC=CC(C)=C14)C5=C(C)C=CC=C5 |
Formula | C22H19N7O |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of IC-87114
95.58% | |
371242-69-2 | |
397.43 | |
C22H19N7O |