You have no items in your shopping cart.
Cart summary
IC-87114
Catalog Number: orb1305207
| Catalog Number | orb1305207 |
|---|---|
| Category | Small Molecules |
| Description | IC-87114 |
| CAS Number | 371242-69-2 |
| Purity | 95.58% |
| MW | 397.43 |
| SMILES | Cc1ccccc1-n1c(Cn2cnc3c(N)ncnc23)nc2cccc(C)c2c1=O |
| Formula | C22H19N7O |
| Biological Activity | IC-87114 is a specific PI3Kδ inhibitor(IC50=0.5 μM). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
- Item 1 of 1
