You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb525617 |
---|---|
Category | Small Molecules |
Description | IACS-010759 (IACS010759) is a small molecule inhibitor of mitochondrial oxidative phosphorylation (OXPHOS), targets complex I of the mitochondrial electron transport chain. |
CAS Number | [1570496-34-2] |
MW | 562.568 |
SMILES | S(C([H])([H])[H])(C1([H])C([H])([H])C([H])([H])N(C2=C([H])C([H])=C([H])C(C([H])([H])N3C(C([H])([H])[H])=NC(C4=NC(C5C([H])=C([H])C(=C([H])C=5[H])OC(F)(F)F)=NO4)=N3)=C2[H])C([H])([H])C1([H])[H])(=O)=O |
Formula | C25H25F3N6O4S |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.83% | |
1570496-34-2 | |
562.56 | |
C25H25F3N6O4S |
98.00% | |
1807523-99-4 | |
599.03 | |
C25H26ClF3N6O4S |