You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb573032 |
---|---|
Category | Small Molecules |
Description | Potent PKC inhibitor. Photosensitizing agent. Potent antileishmanial agent. |
CAS Number | [77029-83-5] |
MW | 546.52 |
SMILES | OC1=C2C(C(C([C@@H](C(C)=O)[C@@](C)(O)C3)=C1OC)=C(C3=C4OC)C5=C6C(OC)=CC(O)=C5C4=O)=C6C(OC)=CC2=O |
Formula | C30H26O10 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥77%, contains ~16% B | |
77029-83-5 | |
546.52 | |
C30H26O10 |
99.81% | |
77029-83-5 | |
546.52 | |
C30H26O10 |