You have no items in your shopping cart.
Cart summary
Hydroxyzine dihydrochloride-d8
Catalog Number: orb2280906
| Catalog Number | orb2280906 |
|---|---|
| Category | Small Molecules |
| Description | Hydroxyzine dihydrochloride-d8 is a deuterated compound of Hydroxyzine dihydrochloride. |
| Purity | 98.00% |
| MW | 455.88 |
| SMILES | ClC1=CC=C(C=C1)[C@H](N2CCN(CC2)C([2H])(C([2H])(OC([2H])(C([2H])(O)[2H])[2H])[2H])[2H])C3=CC=CC=C3.Cl.Cl |
| Formula | C21H21D8Cl3N2O2 |
| Biological Activity | Hydroxyzine dihydrochloride-d8 is a deuterated compound of Hydroxyzine dihydrochloride. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
