You have no items in your shopping cart.
Cart summary
Hoechst 33342 analog trihydrochloride
Catalog Number: orb1984731
| Catalog Number | orb1984731 |
|---|---|
| Category | Small Molecules |
| Description | Hoechst 33342 analog trihydrochloride, an analog of Hoechst 33342, serves as a fluorochrome by binding to the minor groove of DNA, facilitating the visualization of cellular DNA. |
| CAS Number | 159277-19-7 |
| Purity | 98.00% |
| MW | 627.05 |
| SMILES | Cl.CN1CCN(CC1)c1ccc2nc([nH]c2c1)-c1ccc2nc(CCCc3ccc(cc3)N(CCCl)CCCl)[nH]c2c1 |
| Formula | C32H38Cl3N7 |
| Biological Activity | Hoechst 33342 analog trihydrochloride, an analog of Hoechst 33342, serves as a fluorochrome by binding to the minor groove of DNA, facilitating the visualization of cellular DNA. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
