You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1969480 |
---|---|
Category | Tools |
Description | Hoechst 33258 analog 5 |
CAS Number | 23491-55-6 |
MW | 458.56 |
SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC7=CC=CC=C7C=C6 |
Formula | C29H26N6 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
23554-98-5 | |
422.52 | |
C26H26N6 |
98% | |
23491-54-5 | |
422.52 | |
C26H26N6 |
Filter by Rating