You have no items in your shopping cart.
Cart summary
| Catalog Number | orb1307182 |
|---|---|
| Category | Small Molecules |
| Description | Hoechst 33258 analog 3 |
| CAS Number | 23554-98-5 |
| Purity | 98% |
| MW | 422.52 |
| SMILES | CN1CCN(CC1)c1ccc2nc([nH]c2c1)-c1ccc2nc([nH]c2c1)-c1ccc(C)cc1 |
| Formula | C26H26N6 |
| Biological Activity | Hoechst 33258 analog 3 is part of a family of blue fluorescent dyes used to stain DNA. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
Chemical structure of Hoechst 33258 analog 3
