You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb525679 |
---|---|
Category | Small Molecules |
Description | Histrelin is a synthetic gonadotropin-releasing hormone (GNRH) agonist that binds to the GNRH receptor (GNRHR; Ki = 0.2 nM in CHO cells expressing the human receptor). |
CAS Number | [220810-26-4] |
MW | 1383.55 |
SMILES | O=C([C@H](CCC/N=C(/N)\N)NC([C@H](CC(C)C)NC([C@@H](CC1=CN(CC2C=CC=CC=2)C=N1)NC([C@H](CC1C=CC(=CC=1)O)NC([C@H](CO)NC([C@H](CC1=CNC2=CC=CC=C12)NC([C@H](CC1=CN=CN1)NC([C@@H]1CCC(N1)=O)=O)=O)=O)=O)=O)=O)=O)N1CCC[C@H]1C(NCC)=O.OC(C)=O |
Formula | C66H86N18O12.NC2H4O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.91% | |
220810-26-4 | |
1383.55 | |
C68H90N18O14 |
> 98% (HPLC) | |
76712-82-8 | |
1323.5 | |
C66H86N18O12 |