You have no items in your shopping cart.
Cart summary
Guaiacol-d3
Catalog Number: orb2814015
| Catalog Number | orb2814015 |
|---|---|
| Category | Small Molecules |
| Description | Guaiacol-d3 is a deuterated form of Guaiacol, which is a phenolic compound known for its ability to inhibit COX-2 expression and NF-κB activation in response to LPS stimulation, exhibiting anti-inflammatory properties. |
| CAS Number | 74495-69-5 |
| MW | 127.16 |
| SMILES | O(C([2H])([2H])[2H])C1=C(O)C=CC=C1 |
| Formula | C7H8O2 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
