You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb573464 |
---|---|
Category | Small Molecules |
Description | GSK467 is a potent and selective inhibitor of KDM5 (also known as JARID1). GSK467 exploits unique binding modes. |
CAS Number | [1628332-52-4] |
MW | 319.3174 |
SMILES | O(C1=NC2C([H])=NC([H])=C([H])C=2C(N1[H])=O)C1C([H])=NN(C=1[H])C([H])([H])C1C([H])=C([H])C([H])=C([H])C=1[H] |
Formula | C17H13N5O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
100% | |
1628332-52-4 | |
319.32 | |
C17H13N5O2 |