You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb377600 |
---|---|
Category | Small Molecules |
Description | GSK2983559 active metabolite is an active metabolite of GSK2983559. GSK2983559 active metabolite is a receptor interacting protein-2 (RIP2) kinase inhibitor extracted from patent WO/2014043446 A1, compound example 1. |
CAS Number | [1423186-80-4] |
MW | 458.55 |
SMILES | C1=C(S(=O)(=O)C(C)(C)C)C(OCCO)=CC2N=CN=C(NC3=CC4N=CSC=4C=C3)C1=2 |
Formula | C21H22N4O4S2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
1579965-12-0 | |
538.53 | |
C21H23N4O7PS2 |
98.48% | |
1423186-80-4 | |
458.55 | |
C21H22N4O4S2 |
[1579965-12-0] | |
538.53 | |
C21H23N4O7PS2 |