You have no items in your shopping cart.
Cart summary
GRP-60367
Catalog Number: orb1298700
| Catalog Number | orb1298700 |
|---|---|
| Category | Small Molecules |
| Description | GRP-60367 |
| CAS Number | 1309241-34-6 |
| Purity | 99.88% |
| MW | 353.46 |
| SMILES | Cc1ccc(C)c(OCCNC2CCN(CC2)C(=O)c2ccncc2)c1 |
| Formula | C21H27N3O2 |
| Biological Activity | GRP-60367 is the first small molecule rabies virus (RABV) entry inhibitor, which has nanomolar effect on some RABV strains. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
