You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb104696 |
---|---|
Category | Small Molecules |
Description | Gossypol-acetic acid |
CAS Number | [12542-36-8] |
Purity | > 98%,Standard References |
MW | 578.61 |
SMILES | OC1=C(C2=C(O)C(C(C=O)=C3O)=C(C(C(C)C)=C3O)C=C2C)C(C)=CC4=C1C(C=O)=C(O)C(O)=C4C(C)C.CC(O)=O |
Formula | C32H34O10 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of Gossypol-acetic acid
> 98%,Standard References | |
[1189561-66-7] | |
578.6064 | |
C32H34O10 |
99% | |
12542-36-8 | |
578.61 | |
C32H34O10 |
96.73% | |
866541-93-7 | |
578.61 | |
C32H34O10 |