You have no items in your shopping cart.
Cart summary
Gardoside
Catalog Number: orb1684582
| Catalog Number | orb1684582 |
|---|---|
| Category | Small Molecules |
| Description | Gardoside |
| CAS Number | 54835-76-6 |
| Purity | 98% |
| MW | 374.342 |
| SMILES | OCC1OC(OC2OC=C(C3CC(O)C(=C)C23)C(O)=O)C(O)C(O)C1O |c:8| |
| Formula | C16H22O10 |
| Biological Activity | Gardoside is a natural product |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
