You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb525664 |
---|---|
Category | Small Molecules |
Description | Ganirelix is a gonadotropin-releasing hormone receptor (GNRHR) antagonist (IC,sub>50 = 3.6 nM; pA2 = 9.3). |
CAS Number | [129311-55-3] |
MW | 1690.4 |
SMILES | O=C(N[C@H](CC1=CC=C(Cl)C=C1)C(N[C@H](CC2=CN=CC=C2)C(N[C@@H](CO)C(N[C@@H](CC3=CC=C(O)C=C3)C(N[C@H](CCCC/N=C(NCC)/NCC)C(N[C@@H](CC(C)C)C(N[C@@H](CCCC/N=C(NCC)/NCC)C(N4[C@H](C(N[C@H](C)C(N)=O)=O)CCC4)=O)=O)=O)=O)=O)=O)=O)[C@H](NC(C)=O)CC5=CC6=CC=CC=C6C=C5.OC |
Formula | C80H113ClN18O13.2C2H4O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
96.05% | |
123246-29-7 | |
1630.4 | |
C82H117ClN18O15 |