You have no items in your shopping cart.
Cart summary
(−)-G-Lactone
Catalog Number: orb2283228
| Catalog Number | orb2283228 |
|---|---|
| Category | Small Molecules |
| Description | (–)-G-lactone, a bicyclic γ-lactone, serves as a chiral synthon for prostaglandin and a building block. It is formed through an asymmetric Baeyer-Villiger oxidation reaction. Additionally, (–)-G-lactone has been utilized in the synthesis of HIV-1 protease inhibitors. |
| CAS Number | 43119-28-4 |
| Purity | 98.00% |
| MW | 124.139 |
| SMILES | O=C1C[C@@H]2C=CC[C@@H]2O1 |
| Formula | C7H8O2 |
| Biological Activity | (–)-G-lactone, a bicyclic γ-lactone, serves as a chiral synthon for prostaglandin and a building block. It is formed through an asymmetric Baeyer-Villiger oxidation reaction. Additionally, (–)-G-lactone has been utilized in the synthesis of HIV-1 protease inhibitors. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
