You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb525735 |
---|---|
Category | Small Molecules |
Description | Flavoxate Hydrochloride(DW-61 Hydrochloride) is a muscarinic AChR antagonist used in various urinary syndromes and as an antispasmodic. |
CAS Number | [3717-88-2] |
MW | 391.4596 |
SMILES | O(C(C1=C([H])C([H])=C([H])C2C(C(C([H])([H])[H])=C(C3C([H])=C([H])C([H])=C([H])C=3[H])OC1=2)=O)=O)C([H])([H])C([H])([H])N1C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] |
Formula | C24H25NO4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.78% | |
3717-88-2 | |
427.92 | |
C24H26ClNO4 |