You have no items in your shopping cart.
Cart summary
Fenbendazole sulfone
Catalog Number: orb1692507
| Catalog Number | orb1692507 |
|---|---|
| Category | Small Molecules |
| Description | Fenbendazole sulfone |
| CAS Number | 54029-20-8 |
| Purity | 98% |
| MW | 331.35 |
| SMILES | O=C(OC)NC1=NC=2C=CC(=CC2N1)S(=O)(=O)C=3C=CC=CC3 |
| Formula | C15H13N3O4S |
| Biological Activity | Fenbendazole sulfone is a minor metabolite of the anthelmintic fenbendazole . Fenbendazole undergoes oxidation to form oxfendazole, which is further oxidized to form fenbendazole sulfone. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
