You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb746355 |
---|---|
Category | Small Molecules |
Description | FB23 is a potent and selective FTO demethylase inhibitor with an IC50 of 60 nM. FB23 directly binds to FTO and selectively inhibits FTO's mRNA N6-methyladenosine (m6A) demethylase activity. |
CAS Number | [2243736-35-6] |
MW | 377.22 |
SMILES | O=C(O)C1=CC=CC=C1NC2=C(Cl)C=C(C3=C(C)ON=C3C)C=C2Cl |
Formula | C18H14Cl2N2O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.22% | |
2243736-35-6 | |
377.22 | |
C18H14Cl2N2O3 |
[2243736-45-8] | |
392.236 | |
C18H15Cl2N3O3 |
98.91% | |
2243736-45-8 | |
392.24 | |
C18H15Cl2N3O3 |
Filter by Rating