You have no items in your shopping cart.
Cart summary
Ethyl linoleate
Catalog Number: orb1710769
| Catalog Number | orb1710769 |
|---|---|
| Category | Small Molecules |
| Description | Ethyl linoleate is a natural product and can inhibit the expression of inflammatory mediators and the development of atherosclerotic lesions. |
| CAS Number | 544-35-4 |
| Purity | 99.69% |
| MW | 308.5 |
| SMILES | CCCCC\C=C/C\C=C/CCCCCCCC(=O)OCC |
| Formula | C20H36O2 |
| Biological Activity | Ethyl linoleate is a natural product and can inhibit the expression of inflammatory mediators and the development of atherosclerotic lesions. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
