You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134505 |
---|---|
Category | Small Molecules |
Description | Estradiol |
CAS Number | [50-28-2] |
MW | 272.38 |
SMILES | C[C@]1(CC2)[C@](CC[C@@H]1O)([H])[C@@]3([H])[C@@]2([H])C(C=CC(O)=C4)=C4CC3 |
Formula | C18H24O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Estradiol chemical structure
Chemical structure of Estradiol; beta-Estradiol, 17beta-Estradiol, Estrace, Dihydrofolliculin, Oestradiol, Dihydrotheelin, Dihydroxyestrin, Divigel
FC, ICC, IF, IHC-Fr, IHC-P, WB | |
Canine, Rabbit, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Recombinant | |
Unconjugated |
FC, ICC, IF, IHC, WB | |
Human | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, ICC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Porcine | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ICC, IF, IHC-Fr, IHC-P | |
Human | |
Mouse | |
Monoclonal | |
Unconjugated |