You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb134792 |
---|---|
Category | Small Molecules |
Description | Esomeprazole(magnesium) |
CAS Number | [161973-10-0] |
MW | 713.12 |
SMILES | O=S(C1=NC2=CC(OC)=CC=C2[N-]1)CC3=NC=C(C)C(OC)=C3C.O=S(C4=NC5=CC(OC)=CC=C5[N-]4)CC6=NC=C(C)C(OC)=C6C.[Mg+2] |
Formula | C34H36MgN6O6S2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥99% | |
217087-09-7 | |
767.17 | |
2(C17H18N3O3S) Mg 3H2O |
98.71% | |
217087-09-7 | |
767.17 | |
C34H42MgN6O9S2 |
98.84% | |
161973-10-0 | |
713.12 | |
C34H36MgN6O6S2 |
Filter by Rating